C23H37N5O10P2 — CID 140909325
[(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-[butoxy(2-cyanoethoxy)phosphoryl]oxyoxolan-2-yl]methyl butyl 2-isocyanoethyl phosphate (PubChem CID 140909325) has the molecular formula C23H37N5O10P2 and a molecular weight of 605.52 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-[butoxy(2-cyanoethoxy)phosphoryl]oxyoxolan-2-yl]methyl butyl 2-isocyanoethyl phosphate.
| Compound Name | [(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-[butoxy(2-cyanoethoxy)phosphoryl]oxyoxolan-2-yl]methyl butyl 2-isocyanoethyl phosphate |
|---|---|
| PubChem CID | 140909325 |
| Molecular Formula | C23H37N5O10P2 |
| Molecular Weight | 605.52 g/mol |
| Exact Mass | 605.20 |
| IUPAC Name | [(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-[butoxy(2-cyanoethoxy)phosphoryl]oxyoxolan-2-yl]methyl butyl 2-isocyanoethyl phosphate |
| SMILES | [C-]#[N+]CCOP(=O)(OCCCC)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)C[C@@H]1OP(=O)(OCCC#N)OCCCC |
| InChI | InChI=1S/C23H37N5O10P2/c1-4-6-13-32-39(30,35-16-11-26-3)36-18-20-19(17-22(37-20)28-12-9-21(25)27-23(28)29)38-40(31,33-14-7-5-2)34-15-8-10-24/h9,12,19-20,22H,4-8,11,13-18H2,1-2H3,(H2,25,27,29)/t19-,20+,22+,39?,40?/m0/s1 |
| InChIKey | WGGRQFQRRWSANP-MEVNEWMYSA-N |
| XLogP | 4.23 |
| TPSA | 187.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|