C28H31NO4 — CID 140911921
1-[4-hydroxy-4-[2-(4-methoxyphenyl)ethyl]piperidin-1-yl]-2-(2-phenylphenoxy)ethanone (PubChem CID 140911921) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is 1-[4-hydroxy-4-[2-(4-methoxyphenyl)ethyl]piperidin-1-yl]-2-(2-phenylphenoxy)ethanone.
| Compound Name | 1-[4-hydroxy-4-[2-(4-methoxyphenyl)ethyl]piperidin-1-yl]-2-(2-phenylphenoxy)ethanone |
|---|---|
| PubChem CID | 140911921 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 1-[4-hydroxy-4-[2-(4-methoxyphenyl)ethyl]piperidin-1-yl]-2-(2-phenylphenoxy)ethanone |
| SMILES | COc1ccc(CCC2(O)CCN(C(=O)COc3ccccc3-c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H31NO4/c1-32-24-13-11-22(12-14-24)15-16-28(31)17-19-29(20-18-28)27(30)21-33-26-10-6-5-9-25(26)23-7-3-2-4-8-23/h2-14,31H,15-21H2,1H3 |
| InChIKey | OLFPUWYVTYDVTR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |