C31H30GeN2O — CID 140916532
[3-(6-tert-butyl-[1]benzofuro[2,3-b]pyridin-8-yl)benzo[f]quinolin-1-yl]-trimethylgermane (PubChem CID 140916532) has the molecular formula C31H30GeN2O and a molecular weight of 519.20 g/mol. Its IUPAC name is [3-(6-tert-butyl-[1]benzofuro[2,3-b]pyridin-8-yl)benzo[f]quinolin-1-yl]-trimethylgermane.
| Compound Name | [3-(6-tert-butyl-[1]benzofuro[2,3-b]pyridin-8-yl)benzo[f]quinolin-1-yl]-trimethylgermane |
|---|---|
| PubChem CID | 140916532 |
| Molecular Formula | C31H30GeN2O |
| Molecular Weight | 519.20 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | [3-(6-tert-butyl-[1]benzofuro[2,3-b]pyridin-8-yl)benzo[f]quinolin-1-yl]-trimethylgermane |
| SMILES | CC(C)(C)c1cc(-c2cc([Ge](C)(C)C)c3c(ccc4ccccc43)n2)c2oc3ncccc3c2c1 |
| InChI | InChI=1S/C31H30GeN2O/c1-31(2,3)20-16-23-22-12-9-15-33-30(22)35-29(23)24(17-20)27-18-25(32(4,5)6)28-21-11-8-7-10-19(21)13-14-26(28)34-27/h7-18H,1-6H3 |
| InChIKey | NXSIUVXCRWKXGH-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.20 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|