C42H37N3SSi — CID 140920031
6-[4-[4-(10,10-dimethylbenzo[b][1,4]benzothiasilin-4-yl)-2,5-bis(trideuteriomethyl)phenyl]-3-(trideuteriomethyl)phenyl]-4a,11a-dihydrobenzimidazolo[1,2-a]benzimidazole (PubChem CID 140920031) has the molecular formula C42H37N3SSi and a molecular weight of 652.99 g/mol. Its IUPAC name is 6-[4-[4-(10,10-dimethylbenzo[b][1,4]benzothiasilin-4-yl)-2,5-bis(trideuteriomethyl)phenyl]-3-(trideuteriomethyl)phenyl]-4a,11a-dihydrobenzimidazolo[1,2-a]benzimidazole.
| Compound Name | 6-[4-[4-(10,10-dimethylbenzo[b][1,4]benzothiasilin-4-yl)-2,5-bis(trideuteriomethyl)phenyl]-3-(trideuteriomethyl)phenyl]-4a,11a-dihydrobenzimidazolo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 140920031 |
| Molecular Formula | C42H37N3SSi |
| Molecular Weight | 652.99 g/mol |
| Exact Mass | 652.30 |
| IUPAC Name | 6-[4-[4-(10,10-dimethylbenzo[b][1,4]benzothiasilin-4-yl)-2,5-bis(trideuteriomethyl)phenyl]-3-(trideuteriomethyl)phenyl]-4a,11a-dihydrobenzimidazolo[1,2-a]benzimidazole |
| SMILES | [2H]C([2H])([2H])c1cc(N2C3=NC4C=CC=CC4N3c3ccccc32)ccc1-c1cc(C([2H])([2H])[2H])c(-c2cccc3c2Sc2ccccc2[Si]3(C)C)cc1C([2H])([2H])[2H] |
| InChI | InChI=1S/C42H37N3SSi/c1-26-23-29(44-36-16-8-9-17-37(36)45-35-15-7-6-14-34(35)43-42(44)45)21-22-30(26)32-24-28(3)33(25-27(32)2)31-13-12-20-40-41(31)46-38-18-10-11-19-39(38)47(40,4)5/h6-25,34-35H,1-5H3/i1D3,2D3,3D3 |
| InChIKey | JVXTXVSXRCSPKB-GQALSZNTSA-N |
| XLogP | 9.42 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.99 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|