C42H30N2 — CID 169072048
2-methyl-1-[2-(1,2,3,4,5,6,7,8-octadeuterio-10-phenanthren-9-ylanthracen-9-yl)phenyl]-3a,7a-dihydrobenzimidazole (PubChem CID 169072048) has the molecular formula C42H30N2 and a molecular weight of 570.76 g/mol. Its IUPAC name is 2-methyl-1-[2-(1,2,3,4,5,6,7,8-octadeuterio-10-phenanthren-9-ylanthracen-9-yl)phenyl]-3a,7a-dihydrobenzimidazole.
| Compound Name | 2-methyl-1-[2-(1,2,3,4,5,6,7,8-octadeuterio-10-phenanthren-9-ylanthracen-9-yl)phenyl]-3a,7a-dihydrobenzimidazole |
|---|---|
| PubChem CID | 169072048 |
| Molecular Formula | C42H30N2 |
| Molecular Weight | 570.76 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | 2-methyl-1-[2-(1,2,3,4,5,6,7,8-octadeuterio-10-phenanthren-9-ylanthracen-9-yl)phenyl]-3a,7a-dihydrobenzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cc4ccccc4c4ccccc34)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccccc3N3C(C)=NC4C=CC=CC43)c2c1[2H] |
| InChI | InChI=1S/C42H30N2/c1-27-43-38-23-11-13-25-40(38)44(27)39-24-12-10-22-36(39)41-32-18-6-8-20-34(32)42(35-21-9-7-19-33(35)41)37-26-28-14-2-3-15-29(28)30-16-4-5-17-31(30)37/h2-26,38,40H,1H3/i6D,7D,8D,9D,18D,19D,20D,21D |
| InChIKey | DLUWXMQEQFNXMS-SQZIYIKASA-N |
| XLogP | 10.73 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.76 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|