C42H26 — CID 172547641
4-(1,2,3,4,5,6,7-heptadeuterio-10-naphthalen-1-ylanthracen-9-yl)benzo[a]anthracene (PubChem CID 172547641) has the molecular formula C42H26 and a molecular weight of 537.71 g/mol. Its IUPAC name is 4-(1,2,3,4,5,6,7-heptadeuterio-10-naphthalen-1-ylanthracen-9-yl)benzo[a]anthracene.
| Compound Name | 4-(1,2,3,4,5,6,7-heptadeuterio-10-naphthalen-1-ylanthracen-9-yl)benzo[a]anthracene |
|---|---|
| PubChem CID | 172547641 |
| Molecular Formula | C42H26 |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | 4-(1,2,3,4,5,6,7-heptadeuterio-10-naphthalen-1-ylanthracen-9-yl)benzo[a]anthracene |
| SMILES | [2H]c1cc2c(-c3cccc4c3ccc3cc5ccccc5cc34)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3cccc4ccccc34)c2c([2H])c1[2H] |
| InChI | InChI=1S/C42H26/c1-2-13-29-26-40-30(25-28(29)12-1)23-24-33-32(40)20-10-22-35(33)42-38-18-7-5-16-36(38)41(37-17-6-8-19-39(37)42)34-21-9-14-27-11-3-4-15-31(27)34/h1-26H/i5D,6D,7D,8D,16D,17D,18D |
| InChIKey | QFPWNPDPKKRRTC-FCHDHGNPSA-N |
| XLogP | 11.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|