C46H43N3O — CID 140937549
6-[4-[4-(5,5,6,6-tetramethylbenzo[b][1]benzoxepin-1-yl)-2,5-bis(trideuteriomethyl)phenyl]-3-(trideuteriomethyl)phenyl]-4a,11a-dihydrobenzimidazolo[1,2-a]benzimidazole (PubChem CID 140937549) has the molecular formula C46H43N3O and a molecular weight of 662.92 g/mol. Its IUPAC name is 6-[4-[4-(5,5,6,6-tetramethylbenzo[b][1]benzoxepin-1-yl)-2,5-bis(trideuteriomethyl)phenyl]-3-(trideuteriomethyl)phenyl]-4a,11a-dihydrobenzimidazolo[1,2-a]benzimidazole.
| Compound Name | 6-[4-[4-(5,5,6,6-tetramethylbenzo[b][1]benzoxepin-1-yl)-2,5-bis(trideuteriomethyl)phenyl]-3-(trideuteriomethyl)phenyl]-4a,11a-dihydrobenzimidazolo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 140937549 |
| Molecular Formula | C46H43N3O |
| Molecular Weight | 662.92 g/mol |
| Exact Mass | 662.40 |
| IUPAC Name | 6-[4-[4-(5,5,6,6-tetramethylbenzo[b][1]benzoxepin-1-yl)-2,5-bis(trideuteriomethyl)phenyl]-3-(trideuteriomethyl)phenyl]-4a,11a-dihydrobenzimidazolo[1,2-a]benzimidazole |
| SMILES | [2H]C([2H])([2H])c1cc(N2C3=NC4C=CC=CC4N3c3ccccc32)ccc1-c1cc(C([2H])([2H])[2H])c(-c2cccc3c2Oc2ccccc2C(C)(C)C3(C)C)cc1C([2H])([2H])[2H] |
| InChI | InChI=1S/C46H43N3O/c1-28-25-31(48-40-20-11-12-21-41(40)49-39-19-10-9-18-38(39)47-44(48)49)23-24-32(28)34-26-30(3)35(27-29(34)2)33-15-14-17-37-43(33)50-42-22-13-8-16-36(42)45(4,5)46(37,6)7/h8-27,38-39H,1-7H3/i1D3,2D3,3D3 |
| InChIKey | GZHFPIJRNSUKIS-GQALSZNTSA-N |
| XLogP | 11.50 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.92 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |