C12H20N+ — CID 140930937
1-methyl-2,3-di(propan-2-yl)pyridin-1-ium (PubChem CID 140930937) has the molecular formula C12H20N+ and a molecular weight of 178.30 g/mol. Its IUPAC name is 1-methyl-2,3-di(propan-2-yl)pyridin-1-ium.
| Compound Name | 1-methyl-2,3-di(propan-2-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 140930937 |
| Molecular Formula | C12H20N+ |
| Molecular Weight | 178.30 g/mol |
| Exact Mass | 178.16 |
| IUPAC Name | 1-methyl-2,3-di(propan-2-yl)pyridin-1-ium |
| SMILES | CC(C)c1ccc[n+](C)c1C(C)C |
| InChI | InChI=1S/C12H20N/c1-9(2)11-7-6-8-13(5)12(11)10(3)4/h6-10H,1-5H3/q+1 |
| InChIKey | NXMHJEFEMUPXMH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|