C18H16N5Y- — CID 140932580
5,6-dimethyl-7-[1-methyl-3-(2H-pyridin-2-id-3-yl)-4H-pyridin-1-ium-4-id-2-yl]imidazo[1,2-a]imidazole;yttrium (PubChem CID 140932580) has the molecular formula C18H16N5Y- and a molecular weight of 391.27 g/mol. Its IUPAC name is 5,6-dimethyl-7-[1-methyl-3-(2H-pyridin-2-id-3-yl)-4H-pyridin-1-ium-4-id-2-yl]imidazo[1,2-a]imidazole;yttrium.
| Compound Name | 5,6-dimethyl-7-[1-methyl-3-(2H-pyridin-2-id-3-yl)-4H-pyridin-1-ium-4-id-2-yl]imidazo[1,2-a]imidazole;yttrium |
|---|---|
| PubChem CID | 140932580 |
| Molecular Formula | C18H16N5Y- |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 5,6-dimethyl-7-[1-methyl-3-(2H-pyridin-2-id-3-yl)-4H-pyridin-1-ium-4-id-2-yl]imidazo[1,2-a]imidazole;yttrium |
| SMILES | Cc1c(C)n2ccnc2n1-c1c(-c2[c-]nccc2)[c-]cc[n+]1C.[Y] |
| InChI | InChI=1S/C18H16N5.Y/c1-13-14(2)23(18-20-9-11-22(13)18)17-16(7-5-10-21(17)3)15-6-4-8-19-12-15;/h4-6,8-11H,1-3H3;/q-1; |
| InChIKey | XBPVIIHZNZVSEO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 39.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|