C16H18 — CID 140938366
5-[(1E,3E)-2,3-bis(ethenyl)hexa-1,3,5-trienyl]cyclohexa-1,3-diene (PubChem CID 140938366) has the molecular formula C16H18 and a molecular weight of 210.32 g/mol. Its IUPAC name is 5-[(1E,3E)-2,3-bis(ethenyl)hexa-1,3,5-trienyl]cyclohexa-1,3-diene.
| Compound Name | 5-[(1E,3E)-2,3-bis(ethenyl)hexa-1,3,5-trienyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 140938366 |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 5-[(1E,3E)-2,3-bis(ethenyl)hexa-1,3,5-trienyl]cyclohexa-1,3-diene |
| SMILES | C=C/C=C(C=C)/C(C=C)=C/C1C=CC=CC1 |
| InChI | InChI=1S/C16H18/c1-4-10-15(5-2)16(6-3)13-14-11-8-7-9-12-14/h4-11,13-14H,1-3,12H2/b15-10+,16-13+ |
| InChIKey | JVMXVOHSFYNKMU-XGJXTRRESA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|