C8H9NO2 — CID 70035465
5-(2-nitroethenyl)cyclohexa-1,3-diene (PubChem CID 70035465) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 5-(2-nitroethenyl)cyclohexa-1,3-diene.
| Compound Name | 5-(2-nitroethenyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 70035465 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 5-(2-nitroethenyl)cyclohexa-1,3-diene |
| SMILES | O=[N+]([O-])C=CC1C=CC=CC1 |
| InChI | InChI=1S/C8H9NO2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-4,6-8H,5H2 |
| InChIKey | NYGXGQJKMAKQHM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|