C14H17FN2O2 — CID 140944841
(2S)-2-amino-3-(4-fluoro-1H-indol-3-yl)hexanoic acid (PubChem CID 140944841) has the molecular formula C14H17FN2O2 and a molecular weight of 264.30 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-fluoro-1H-indol-3-yl)hexanoic acid.
| Compound Name | (2S)-2-amino-3-(4-fluoro-1H-indol-3-yl)hexanoic acid |
|---|---|
| PubChem CID | 140944841 |
| Molecular Formula | C14H17FN2O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | (2S)-2-amino-3-(4-fluoro-1H-indol-3-yl)hexanoic acid |
| SMILES | CCCC(c1c[nH]c2cccc(F)c12)[C@H](N)C(=O)O |
| InChI | InChI=1S/C14H17FN2O2/c1-2-4-8(13(16)14(18)19)9-7-17-11-6-3-5-10(15)12(9)11/h3,5-8,13,17H,2,4,16H2,1H3,(H,18,19)/t8?,13-/m0/s1 |
| InChIKey | IRQNMEROFXVSGY-RLROJCQXSA-N |
| XLogP | 2.60 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |