C20H16O6 — CID 140965620
2-[4-(carboxymethyl)-5,7-dimethyl-9,10-dioxoanthracen-2-yl]acetic acid (PubChem CID 140965620) has the molecular formula C20H16O6 and a molecular weight of 352.34 g/mol. Its IUPAC name is 2-[4-(carboxymethyl)-5,7-dimethyl-9,10-dioxoanthracen-2-yl]acetic acid.
| Compound Name | 2-[4-(carboxymethyl)-5,7-dimethyl-9,10-dioxoanthracen-2-yl]acetic acid |
|---|---|
| PubChem CID | 140965620 |
| Molecular Formula | C20H16O6 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2-[4-(carboxymethyl)-5,7-dimethyl-9,10-dioxoanthracen-2-yl]acetic acid |
| SMILES | Cc1cc(C)c2c(c1)C(=O)c1cc(CC(=O)O)cc(CC(=O)O)c1C2=O |
| InChI | InChI=1S/C20H16O6/c1-9-3-10(2)17-13(4-9)19(25)14-6-11(7-15(21)22)5-12(8-16(23)24)18(14)20(17)26/h3-6H,7-8H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | TXQXXINQEAMVKB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|