C19H17N3O4S — CID 140968033
[3-[(2-amino-2-oxo-1-pyridin-4-ylethyl)amino]phenyl] benzenesulfonate (PubChem CID 140968033) has the molecular formula C19H17N3O4S and a molecular weight of 383.43 g/mol. Its IUPAC name is [3-[(2-amino-2-oxo-1-pyridin-4-ylethyl)amino]phenyl] benzenesulfonate.
| Compound Name | [3-[(2-amino-2-oxo-1-pyridin-4-ylethyl)amino]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 140968033 |
| Molecular Formula | C19H17N3O4S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | [3-[(2-amino-2-oxo-1-pyridin-4-ylethyl)amino]phenyl] benzenesulfonate |
| SMILES | NC(=O)C(Nc1cccc(OS(=O)(=O)c2ccccc2)c1)c1ccncc1 |
| InChI | InChI=1S/C19H17N3O4S/c20-19(23)18(14-9-11-21-12-10-14)22-15-5-4-6-16(13-15)26-27(24,25)17-7-2-1-3-8-17/h1-13,18,22H,(H2,20,23) |
| InChIKey | RKCJBWDDDORGQL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|