C12H18O — CID 140968985
2,5,7-trimethyl-2,3,4,5-tetrahydro-1H-inden-1-ol (PubChem CID 140968985) has the molecular formula C12H18O and a molecular weight of 178.28 g/mol. Its IUPAC name is 2,5,7-trimethyl-2,3,4,5-tetrahydro-1H-inden-1-ol.
| Compound Name | 2,5,7-trimethyl-2,3,4,5-tetrahydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 140968985 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 2,5,7-trimethyl-2,3,4,5-tetrahydro-1H-inden-1-ol |
| SMILES | CC1=CC(C)CC2=C1C(O)C(C)C2 |
| InChI | InChI=1S/C12H18O/c1-7-4-8(2)11-10(5-7)6-9(3)12(11)13/h4,7,9,12-13H,5-6H2,1-3H3 |
| InChIKey | CCSLYFJUIFHXAG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |