About 1,5-dimethyl-3-[(E)-prop-1-enyl]cyclohexa-1,3-diene
1,5-dimethyl-3-[(E)-prop-1-enyl]cyclohexa-1,3-diene (PubChem CID 143620880) has the molecular formula C11H16
and a molecular weight of 148.25 g/mol. Its IUPAC name is 1,5-dimethyl-3-[(E)-prop-1-enyl]cyclohexa-1,3-diene.
Analyze 1,5-dimethyl-3-[(E)-prop-1-enyl]cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-3-[(E)-prop-1-enyl]cyclohexa-1,3-diene?
The IUPAC name of 1,5-dimethyl-3-[(E)-prop-1-enyl]cyclohexa-1,3-diene (CID 143620880) is 1,5-dimethyl-3-[(E)-prop-1-enyl]cyclohexa-1,3-diene.
What is the SMILES notation for 1,5-dimethyl-3-[(E)-prop-1-enyl]cyclohexa-1,3-diene?
The canonical SMILES for 1,5-dimethyl-3-[(E)-prop-1-enyl]cyclohexa-1,3-diene is C/C=C/C1=CC(C)CC(C)=C1.
What is the InChIKey of 1,5-dimethyl-3-[(E)-prop-1-enyl]cyclohexa-1,3-diene?
The InChIKey is BYBYCAQDVGQQIB-SNAWJCMRSA-N. The full InChI is InChI=1S/C11H16/c1-4-5-11-7-9(2)6-10(3)8-11/h4-5,7-9H,6H2,1-3H3/b5-4+.
What are the key properties of 1,5-dimethyl-3-[(E)-prop-1-enyl]cyclohexa-1,3-diene?
1,5-dimethyl-3-[(E)-prop-1-enyl]cyclohexa-1,3-diene has a molecular weight of 148.25 g/mol, XLogP of 3.47, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-3-[(E)-prop-1-enyl]cyclohexa-1,3-diene is sourced from PubChem (CID 143620880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).