C13H21P — CID 142155508
2-(3,5-dimethylcyclohexa-2,4-dien-1-yl)pent-3-en-2-ylphosphane (PubChem CID 142155508) has the molecular formula C13H21P and a molecular weight of 208.28 g/mol. Its IUPAC name is 2-(3,5-dimethylcyclohexa-2,4-dien-1-yl)pent-3-en-2-ylphosphane.
| Compound Name | 2-(3,5-dimethylcyclohexa-2,4-dien-1-yl)pent-3-en-2-ylphosphane |
|---|---|
| PubChem CID | 142155508 |
| Molecular Formula | C13H21P |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 2-(3,5-dimethylcyclohexa-2,4-dien-1-yl)pent-3-en-2-ylphosphane |
| SMILES | CC=CC(C)(P)C1C=C(C)C=C(C)C1 |
| InChI | InChI=1S/C13H21P/c1-5-6-13(4,14)12-8-10(2)7-11(3)9-12/h5-8,12H,9,14H2,1-4H3 |
| InChIKey | OMIOMVUPKDXSJB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|