C17H26O5 — CID 162861776
(2S,3R,3aR,7aS)-3-hydroxy-2-methoxy-2-(3-methoxy-3-methylbut-1-enyl)-3,6-dimethyl-7,7a-dihydro-3aH-1-benzofuran-4-one (PubChem CID 162861776) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is (2S,3R,3aR,7aS)-3-hydroxy-2-methoxy-2-(3-methoxy-3-methylbut-1-enyl)-3,6-dimethyl-7,7a-dihydro-3aH-1-benzofuran-4-one.
| Compound Name | (2S,3R,3aR,7aS)-3-hydroxy-2-methoxy-2-(3-methoxy-3-methylbut-1-enyl)-3,6-dimethyl-7,7a-dihydro-3aH-1-benzofuran-4-one |
|---|---|
| PubChem CID | 162861776 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (2S,3R,3aR,7aS)-3-hydroxy-2-methoxy-2-(3-methoxy-3-methylbut-1-enyl)-3,6-dimethyl-7,7a-dihydro-3aH-1-benzofuran-4-one |
| SMILES | COC(C)(C)C=C[C@]1(OC)O[C@H]2CC(C)=CC(=O)[C@H]2[C@@]1(C)O |
| InChI | InChI=1S/C17H26O5/c1-11-9-12(18)14-13(10-11)22-17(21-6,16(14,4)19)8-7-15(2,3)20-5/h7-9,13-14,19H,10H2,1-6H3/t13-,14+,16+,17-/m0/s1 |
| InChIKey | DLCYYQBRCUDKTK-ABFRBSLYSA-N |
| XLogP | 2.00 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|