C26H25NO7 — CID 140973353
phenylmethoxycarbonyl 2-(2,4-dimethoxyphenyl)-4-phenyl-1,3-oxazolidine-5-carboxylate (PubChem CID 140973353) has the molecular formula C26H25NO7 and a molecular weight of 463.49 g/mol. Its IUPAC name is phenylmethoxycarbonyl 2-(2,4-dimethoxyphenyl)-4-phenyl-1,3-oxazolidine-5-carboxylate.
| Compound Name | phenylmethoxycarbonyl 2-(2,4-dimethoxyphenyl)-4-phenyl-1,3-oxazolidine-5-carboxylate |
|---|---|
| PubChem CID | 140973353 |
| Molecular Formula | C26H25NO7 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | phenylmethoxycarbonyl 2-(2,4-dimethoxyphenyl)-4-phenyl-1,3-oxazolidine-5-carboxylate |
| SMILES | COc1ccc(C2NC(c3ccccc3)C(C(=O)OC(=O)OCc3ccccc3)O2)c(OC)c1 |
| InChI | InChI=1S/C26H25NO7/c1-30-19-13-14-20(21(15-19)31-2)24-27-22(18-11-7-4-8-12-18)23(33-24)25(28)34-26(29)32-16-17-9-5-3-6-10-17/h3-15,22-24,27H,16H2,1-2H3 |
| InChIKey | YKKYFKQXZZOFLL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|