C25H42 — CID 140976795
4,5,7-trimethyl-7-pent-1-en-2-yl-6-pent-1-en-3-yldodeca-1,5,8-triene (PubChem CID 140976795) has the molecular formula C25H42 and a molecular weight of 342.61 g/mol. Its IUPAC name is 4,5,7-trimethyl-7-pent-1-en-2-yl-6-pent-1-en-3-yldodeca-1,5,8-triene.
| Compound Name | 4,5,7-trimethyl-7-pent-1-en-2-yl-6-pent-1-en-3-yldodeca-1,5,8-triene |
|---|---|
| PubChem CID | 140976795 |
| Molecular Formula | C25H42 |
| Molecular Weight | 342.61 g/mol |
| Exact Mass | 342.33 |
| IUPAC Name | 4,5,7-trimethyl-7-pent-1-en-2-yl-6-pent-1-en-3-yldodeca-1,5,8-triene |
| SMILES | C=CCC(C)C(C)=C(C(C=C)CC)C(C)(C=CCCC)C(=C)CCC |
| InChI | InChI=1S/C25H42/c1-10-15-16-19-25(9,21(7)18-12-3)24(23(13-4)14-5)22(8)20(6)17-11-2/h11,13,16,19-20,23H,2,4,7,10,12,14-15,17-18H2,1,3,5-6,8-9H3 |
| InChIKey | PRFLLHRPYFFEOM-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.61 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|