C14H24O — CID 140979510
3,3-dimethyl-5-methylidene-1-pentoxycyclohexene (PubChem CID 140979510) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 3,3-dimethyl-5-methylidene-1-pentoxycyclohexene.
| Compound Name | 3,3-dimethyl-5-methylidene-1-pentoxycyclohexene |
|---|---|
| PubChem CID | 140979510 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 3,3-dimethyl-5-methylidene-1-pentoxycyclohexene |
| SMILES | C=C1CC(OCCCCC)=CC(C)(C)C1 |
| InChI | InChI=1S/C14H24O/c1-5-6-7-8-15-13-9-12(2)10-14(3,4)11-13/h11H,2,5-10H2,1,3-4H3 |
| InChIKey | KIQCJHYAZWCXSV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|