C11H18ClNO5S — CID 140979676
(2S)-2-[chloromethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-oxo-2-(sulfanylmethyl)butanoic acid (PubChem CID 140979676) has the molecular formula C11H18ClNO5S and a molecular weight of 311.79 g/mol. Its IUPAC name is (2S)-2-[chloromethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-oxo-2-(sulfanylmethyl)butanoic acid.
| Compound Name | (2S)-2-[chloromethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-oxo-2-(sulfanylmethyl)butanoic acid |
|---|---|
| PubChem CID | 140979676 |
| Molecular Formula | C11H18ClNO5S |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | (2S)-2-[chloromethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-oxo-2-(sulfanylmethyl)butanoic acid |
| SMILES | CC(=O)[C@@](CS)(C(=O)O)N(CCl)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H18ClNO5S/c1-7(14)11(5-19,8(15)16)13(6-12)9(17)18-10(2,3)4/h19H,5-6H2,1-4H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | WMTXXQJYHOUXNP-NSHDSACASA-N |
| XLogP | 1.76 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|