About 1-(3-chloropentan-3-yl)-2,3-diethylbenzene
1-(3-chloropentan-3-yl)-2,3-diethylbenzene (PubChem CID 140983253) has the molecular formula C15H23Cl
and a molecular weight of 238.80 g/mol. Its IUPAC name is 1-(3-chloropentan-3-yl)-2,3-diethylbenzene.
Molecular Properties
| Compound Name | 1-(3-chloropentan-3-yl)-2,3-diethylbenzene |
| PubChem CID | 140983253 |
| Molecular Formula | C15H23Cl |
| Molecular Weight | 238.80 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1-(3-chloropentan-3-yl)-2,3-diethylbenzene |
| SMILES | CCc1cccc(C(Cl)(CC)CC)c1CC |
| InChI | InChI=1S/C15H23Cl/c1-5-12-10-9-11-14(13(12)6-2)15(16,7-3)8-4/h9-11H,5-8H2,1-4H3 |
| InChIKey | QBVJDYAXDHIOOX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 238.80 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-chloropentan-3-yl)-2,3-diethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloropentan-3-yl)-2,3-diethylbenzene?
The IUPAC name of 1-(3-chloropentan-3-yl)-2,3-diethylbenzene (CID 140983253) is 1-(3-chloropentan-3-yl)-2,3-diethylbenzene.
What is the SMILES notation for 1-(3-chloropentan-3-yl)-2,3-diethylbenzene?
The canonical SMILES for 1-(3-chloropentan-3-yl)-2,3-diethylbenzene is CCc1cccc(C(Cl)(CC)CC)c1CC.
What is the InChIKey of 1-(3-chloropentan-3-yl)-2,3-diethylbenzene?
The InChIKey is QBVJDYAXDHIOOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23Cl/c1-5-12-10-9-11-14(13(12)6-2)15(16,7-3)8-4/h9-11H,5-8H2,1-4H3.
What are the key properties of 1-(3-chloropentan-3-yl)-2,3-diethylbenzene?
1-(3-chloropentan-3-yl)-2,3-diethylbenzene has a molecular weight of 238.80 g/mol, XLogP of 5.07, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloropentan-3-yl)-2,3-diethylbenzene is sourced from PubChem (CID 140983253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).