C11H15NS — CID 140990864
6-ethyl-3-methyl-2,4-dihydro-1,3-benzothiazine (PubChem CID 140990864) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is 6-ethyl-3-methyl-2,4-dihydro-1,3-benzothiazine.
| Compound Name | 6-ethyl-3-methyl-2,4-dihydro-1,3-benzothiazine |
|---|---|
| PubChem CID | 140990864 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 6-ethyl-3-methyl-2,4-dihydro-1,3-benzothiazine |
| SMILES | CCc1ccc2c(c1)CN(C)CS2 |
| InChI | InChI=1S/C11H15NS/c1-3-9-4-5-11-10(6-9)7-12(2)8-13-11/h4-6H,3,7-8H2,1-2H3 |
| InChIKey | ZDXUPEMOLFQMLT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |