About dioxido(pyren-1-yl)borane;bis(tetrabutylazanium)
dioxido(pyren-1-yl)borane;bis(tetrabutylazanium) (PubChem CID 140995835) has the molecular formula C48H81BN2O2
and a molecular weight of 729.00 g/mol. Its IUPAC name is dioxido(pyren-1-yl)borane;bis(tetrabutylazanium).
Molecular Properties
| Compound Name | dioxido(pyren-1-yl)borane;bis(tetrabutylazanium) |
| PubChem CID | 140995835 |
| Molecular Formula | C48H81BN2O2 |
| Molecular Weight | 729.00 g/mol |
| Exact Mass | 728.64 |
| IUPAC Name | dioxido(pyren-1-yl)borane;bis(tetrabutylazanium) |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC.[O-]B([O-])c1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C16H9BO2.2C16H36N/c18-17(19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11;2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h1-9H;2*5-16H2,1-4H3/q-2;2*+1 |
| InChIKey | NQFLMVOADXFKRX-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 729.00 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dioxido(pyren-1-yl)borane;bis(tetrabutylazanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(pyren-1-yl)borane;bis(tetrabutylazanium)?
The IUPAC name of dioxido(pyren-1-yl)borane;bis(tetrabutylazanium) (CID 140995835) is dioxido(pyren-1-yl)borane;bis(tetrabutylazanium).
What is the SMILES notation for dioxido(pyren-1-yl)borane;bis(tetrabutylazanium)?
The canonical SMILES for dioxido(pyren-1-yl)borane;bis(tetrabutylazanium) is CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC.[O-]B([O-])c1ccc2ccc3cccc4ccc1c2c34.
What is the InChIKey of dioxido(pyren-1-yl)borane;bis(tetrabutylazanium)?
The InChIKey is NQFLMVOADXFKRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9BO2.2C16H36N/c18-17(19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11;2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h1-9H;2*5-16H2,1-4H3/q-2;2*+1.
What are the key properties of dioxido(pyren-1-yl)borane;bis(tetrabutylazanium)?
dioxido(pyren-1-yl)borane;bis(tetrabutylazanium) has a molecular weight of 729.00 g/mol, XLogP of 11.01, 25 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(pyren-1-yl)borane;bis(tetrabutylazanium) is sourced from PubChem (CID 140995835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).