C13H11NO — CID 141000317
3-methyl-1,4-dihydrobenzo[f]indol-2-one (PubChem CID 141000317) has the molecular formula C13H11NO and a molecular weight of 197.24 g/mol. Its IUPAC name is 3-methyl-1,4-dihydrobenzo[f]indol-2-one.
| Compound Name | 3-methyl-1,4-dihydrobenzo[f]indol-2-one |
|---|---|
| PubChem CID | 141000317 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 3-methyl-1,4-dihydrobenzo[f]indol-2-one |
| SMILES | CC1=C2Cc3ccccc3C=C2NC1=O |
| InChI | InChI=1S/C13H11NO/c1-8-11-6-9-4-2-3-5-10(9)7-12(11)14-13(8)15/h2-5,7H,6H2,1H3,(H,14,15) |
| InChIKey | XEJKDTXVIRKULV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |