C22H14Cl2FN3O — CID 14100150
4,5-bis(4-chlorophenyl)-N-(4-fluorophenyl)-1H-imidazole-2-carboxamide (PubChem CID 14100150) has the molecular formula C22H14Cl2FN3O and a molecular weight of 426.28 g/mol. Its IUPAC name is 4,5-bis(4-chlorophenyl)-N-(4-fluorophenyl)-1H-imidazole-2-carboxamide.
| Compound Name | 4,5-bis(4-chlorophenyl)-N-(4-fluorophenyl)-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 14100150 |
| Molecular Formula | C22H14Cl2FN3O |
| Molecular Weight | 426.28 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 4,5-bis(4-chlorophenyl)-N-(4-fluorophenyl)-1H-imidazole-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1nc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)[nH]1 |
| InChI | InChI=1S/C22H14Cl2FN3O/c23-15-5-1-13(2-6-15)19-20(14-3-7-16(24)8-4-14)28-21(27-19)22(29)26-18-11-9-17(25)10-12-18/h1-12H,(H,26,29)(H,27,28) |
| InChIKey | BBTIXNLCYPJVAV-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.28 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |