C11H9ClFNO5 — CID 141007422
1-fluoro-8-methoxy-3,4-dioxo-2H-quinoline-2-carboxylic acid;hydrochloride (PubChem CID 141007422) has the molecular formula C11H9ClFNO5 and a molecular weight of 289.65 g/mol. Its IUPAC name is 1-fluoro-8-methoxy-3,4-dioxo-2H-quinoline-2-carboxylic acid;hydrochloride.
| Compound Name | 1-fluoro-8-methoxy-3,4-dioxo-2H-quinoline-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 141007422 |
| Molecular Formula | C11H9ClFNO5 |
| Molecular Weight | 289.65 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 1-fluoro-8-methoxy-3,4-dioxo-2H-quinoline-2-carboxylic acid;hydrochloride |
| SMILES | COc1cccc2c1N(F)C(C(=O)O)C(=O)C2=O.Cl |
| InChI | InChI=1S/C11H8FNO5.ClH/c1-18-6-4-2-3-5-7(6)13(12)8(11(16)17)10(15)9(5)14;/h2-4,8H,1H3,(H,16,17);1H |
| InChIKey | QPDUZMHOPGJLIV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.65 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|