C19H15NO5S2 — CID 3719228
6-(benzenesulfonyl)-7-methoxybenzo[c][1,2]benzothiazine 5,5-dioxide (PubChem CID 3719228) has the molecular formula C19H15NO5S2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 6-(benzenesulfonyl)-7-methoxybenzo[c][1,2]benzothiazine 5,5-dioxide.
| Compound Name | 6-(benzenesulfonyl)-7-methoxybenzo[c][1,2]benzothiazine 5,5-dioxide |
|---|---|
| PubChem CID | 3719228 |
| Molecular Formula | C19H15NO5S2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 6-(benzenesulfonyl)-7-methoxybenzo[c][1,2]benzothiazine 5,5-dioxide |
| SMILES | COc1cccc2c1N(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1-2 |
| InChI | InChI=1S/C19H15NO5S2/c1-25-17-12-7-11-16-15-10-5-6-13-18(15)27(23,24)20(19(16)17)26(21,22)14-8-3-2-4-9-14/h2-13H,1H3 |
| InChIKey | AUMVHMDOFQXABW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |