C12H16ClNS — CID 141008713
2-(3-chloropropyl)-3,3-dimethyl-1,2-benzothiazole (PubChem CID 141008713) has the molecular formula C12H16ClNS and a molecular weight of 241.79 g/mol. Its IUPAC name is 2-(3-chloropropyl)-3,3-dimethyl-1,2-benzothiazole.
| Compound Name | 2-(3-chloropropyl)-3,3-dimethyl-1,2-benzothiazole |
|---|---|
| PubChem CID | 141008713 |
| Molecular Formula | C12H16ClNS |
| Molecular Weight | 241.79 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 2-(3-chloropropyl)-3,3-dimethyl-1,2-benzothiazole |
| SMILES | CC1(C)c2ccccc2SN1CCCCl |
| InChI | InChI=1S/C12H16ClNS/c1-12(2)10-6-3-4-7-11(10)15-14(12)9-5-8-13/h3-4,6-7H,5,8-9H2,1-2H3 |
| InChIKey | LWOCCULBQIBFJN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.79 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|