C9H12N2S — CID 166904749
3,3-dimethyl-1,2-benzothiazol-2-amine (PubChem CID 166904749) has the molecular formula C9H12N2S and a molecular weight of 180.28 g/mol. Its IUPAC name is 3,3-dimethyl-1,2-benzothiazol-2-amine.
| Compound Name | 3,3-dimethyl-1,2-benzothiazol-2-amine |
|---|---|
| PubChem CID | 166904749 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 3,3-dimethyl-1,2-benzothiazol-2-amine |
| SMILES | CC1(C)c2ccccc2SN1N |
| InChI | InChI=1S/C9H12N2S/c1-9(2)7-5-3-4-6-8(7)12-11(9)10/h3-6H,10H2,1-2H3 |
| InChIKey | DCAXBRWPPBRSHI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|