About 3,3-dimethyl-1,2-benzothiazol-2-amine
3,3-dimethyl-1,2-benzothiazol-2-amine (PubChem CID 166904749) has the molecular formula C9H12N2S
and a molecular weight of 180.28 g/mol. Its IUPAC name is 3,3-dimethyl-1,2-benzothiazol-2-amine.
Molecular Properties
| Compound Name | 3,3-dimethyl-1,2-benzothiazol-2-amine |
| PubChem CID | 166904749 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 3,3-dimethyl-1,2-benzothiazol-2-amine |
| SMILES | CC1(C)c2ccccc2SN1N |
| InChI | InChI=1S/C9H12N2S/c1-9(2)7-5-3-4-6-8(7)12-11(9)10/h3-6H,10H2,1-2H3 |
| InChIKey | DCAXBRWPPBRSHI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyl-1,2-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1,2-benzothiazol-2-amine?
The IUPAC name of 3,3-dimethyl-1,2-benzothiazol-2-amine (CID 166904749) is 3,3-dimethyl-1,2-benzothiazol-2-amine.
What is the SMILES notation for 3,3-dimethyl-1,2-benzothiazol-2-amine?
The canonical SMILES for 3,3-dimethyl-1,2-benzothiazol-2-amine is CC1(C)c2ccccc2SN1N.
What is the InChIKey of 3,3-dimethyl-1,2-benzothiazol-2-amine?
The InChIKey is DCAXBRWPPBRSHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2S/c1-9(2)7-5-3-4-6-8(7)12-11(9)10/h3-6H,10H2,1-2H3.
What are the key properties of 3,3-dimethyl-1,2-benzothiazol-2-amine?
3,3-dimethyl-1,2-benzothiazol-2-amine has a molecular weight of 180.28 g/mol, XLogP of 2.12, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1,2-benzothiazol-2-amine is sourced from PubChem (CID 166904749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).