C11H14O2S — CID 15731489
2,3-dimethoxy-3-methyl-2H-1-benzothiophene (PubChem CID 15731489) has the molecular formula C11H14O2S and a molecular weight of 210.30 g/mol. Its IUPAC name is 2,3-dimethoxy-3-methyl-2H-1-benzothiophene.
| Compound Name | 2,3-dimethoxy-3-methyl-2H-1-benzothiophene |
|---|---|
| PubChem CID | 15731489 |
| Molecular Formula | C11H14O2S |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 2,3-dimethoxy-3-methyl-2H-1-benzothiophene |
| SMILES | COC1Sc2ccccc2C1(C)OC |
| InChI | InChI=1S/C11H14O2S/c1-11(13-3)8-6-4-5-7-9(8)14-10(11)12-2/h4-7,10H,1-3H3 |
| InChIKey | OEUIXOYGNFBGOV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |