C12H15BrS — CID 86757174
2-(bromomethyl)-4,4-dimethyl-2,3-dihydrothiochromene (PubChem CID 86757174) has the molecular formula C12H15BrS and a molecular weight of 271.22 g/mol. Its IUPAC name is 2-(bromomethyl)-4,4-dimethyl-2,3-dihydrothiochromene.
| Compound Name | 2-(bromomethyl)-4,4-dimethyl-2,3-dihydrothiochromene |
|---|---|
| PubChem CID | 86757174 |
| Molecular Formula | C12H15BrS |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 2-(bromomethyl)-4,4-dimethyl-2,3-dihydrothiochromene |
| SMILES | CC1(C)CC(CBr)Sc2ccccc21 |
| InChI | InChI=1S/C12H15BrS/c1-12(2)7-9(8-13)14-11-6-4-3-5-10(11)12/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | CGMPKVCMAYZWQF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|