C9H8Br2S — CID 163861029
2,3-dibromo-3-methyl-2H-1-benzothiophene (PubChem CID 163861029) has the molecular formula C9H8Br2S and a molecular weight of 308.04 g/mol. Its IUPAC name is 2,3-dibromo-3-methyl-2H-1-benzothiophene.
| Compound Name | 2,3-dibromo-3-methyl-2H-1-benzothiophene |
|---|---|
| PubChem CID | 163861029 |
| Molecular Formula | C9H8Br2S |
| Molecular Weight | 308.04 g/mol |
| Exact Mass | 305.87 |
| IUPAC Name | 2,3-dibromo-3-methyl-2H-1-benzothiophene |
| SMILES | CC1(Br)c2ccccc2SC1Br |
| InChI | InChI=1S/C9H8Br2S/c1-9(11)6-4-2-3-5-7(6)12-8(9)10/h2-5,8H,1H3 |
| InChIKey | PCNXJJLLEAKRTL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.04 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|