C16H33FO4 — CID 141013786
[1-butan-2-yloxy-1-butoxy-2-methyl-1-(2-methylpropoxy)propan-2-yl] hypofluorite (PubChem CID 141013786) has the molecular formula C16H33FO4 and a molecular weight of 308.43 g/mol. Its IUPAC name is [1-butan-2-yloxy-1-butoxy-2-methyl-1-(2-methylpropoxy)propan-2-yl] hypofluorite.
| Compound Name | [1-butan-2-yloxy-1-butoxy-2-methyl-1-(2-methylpropoxy)propan-2-yl] hypofluorite |
|---|---|
| PubChem CID | 141013786 |
| Molecular Formula | C16H33FO4 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | [1-butan-2-yloxy-1-butoxy-2-methyl-1-(2-methylpropoxy)propan-2-yl] hypofluorite |
| SMILES | CCCCOC(OCC(C)C)(OC(C)CC)C(C)(C)OF |
| InChI | InChI=1S/C16H33FO4/c1-8-10-11-18-16(15(6,7)21-17,19-12-13(3)4)20-14(5)9-2/h13-14H,8-12H2,1-7H3 |
| InChIKey | XNTUCAIIIXIXDS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|