C25H51FO8 — CID 148549830
[1-butan-2-yloxy-1-butoxy-3-ethoxy-2-(methoxymethyl)-1-(2-methylpropoxy)-3-propan-2-yloxy-3-propoxypropan-2-yl] hypofluorite (PubChem CID 148549830) has the molecular formula C25H51FO8 and a molecular weight of 498.67 g/mol. Its IUPAC name is [1-butan-2-yloxy-1-butoxy-3-ethoxy-2-(methoxymethyl)-1-(2-methylpropoxy)-3-propan-2-yloxy-3-propoxypropan-2-yl] hypofluorite.
| Compound Name | [1-butan-2-yloxy-1-butoxy-3-ethoxy-2-(methoxymethyl)-1-(2-methylpropoxy)-3-propan-2-yloxy-3-propoxypropan-2-yl] hypofluorite |
|---|---|
| PubChem CID | 148549830 |
| Molecular Formula | C25H51FO8 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.36 |
| IUPAC Name | [1-butan-2-yloxy-1-butoxy-3-ethoxy-2-(methoxymethyl)-1-(2-methylpropoxy)-3-propan-2-yloxy-3-propoxypropan-2-yl] hypofluorite |
| SMILES | CCCCOC(OCC(C)C)(OC(C)CC)C(COC)(OF)C(OCC)(OCCC)OC(C)C |
| InChI | InChI=1S/C25H51FO8/c1-11-15-17-30-25(31-18-20(5)6,33-22(9)13-3)23(34-26,19-27-10)24(28-14-4,29-16-12-2)32-21(7)8/h20-22H,11-19H2,1-10H3 |
| InChIKey | POBVFBZSGDEOTI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|