C14H25F5O6 — CID 151701925
2-[ethoxy(difluoro)methoxy]-1-methoxy-1-propan-2-yloxy-1-propoxy-2-(trifluoromethoxy)propane (PubChem CID 151701925) has the molecular formula C14H25F5O6 and a molecular weight of 384.34 g/mol. Its IUPAC name is 2-[ethoxy(difluoro)methoxy]-1-methoxy-1-propan-2-yloxy-1-propoxy-2-(trifluoromethoxy)propane.
| Compound Name | 2-[ethoxy(difluoro)methoxy]-1-methoxy-1-propan-2-yloxy-1-propoxy-2-(trifluoromethoxy)propane |
|---|---|
| PubChem CID | 151701925 |
| Molecular Formula | C14H25F5O6 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-[ethoxy(difluoro)methoxy]-1-methoxy-1-propan-2-yloxy-1-propoxy-2-(trifluoromethoxy)propane |
| SMILES | CCCOC(OC)(OC(C)C)C(C)(OC(F)(F)F)OC(F)(F)OCC |
| InChI | InChI=1S/C14H25F5O6/c1-7-9-22-12(20-6,23-10(3)4)11(5,24-13(15,16)17)25-14(18,19)21-8-2/h10H,7-9H2,1-6H3 |
| InChIKey | REUBQZKKVWVKQF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|