C21H42O8 — CID 150942263
3-butoxy-2-(2-ethoxy-3-methoxybutan-2-yl)oxy-2-methyl-3-propan-2-yloxy-3-propoxypropanoic acid (PubChem CID 150942263) has the molecular formula C21H42O8 and a molecular weight of 422.56 g/mol. Its IUPAC name is 3-butoxy-2-(2-ethoxy-3-methoxybutan-2-yl)oxy-2-methyl-3-propan-2-yloxy-3-propoxypropanoic acid.
| Compound Name | 3-butoxy-2-(2-ethoxy-3-methoxybutan-2-yl)oxy-2-methyl-3-propan-2-yloxy-3-propoxypropanoic acid |
|---|---|
| PubChem CID | 150942263 |
| Molecular Formula | C21H42O8 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | 3-butoxy-2-(2-ethoxy-3-methoxybutan-2-yl)oxy-2-methyl-3-propan-2-yloxy-3-propoxypropanoic acid |
| SMILES | CCCCOC(OCCC)(OC(C)C)C(C)(OC(C)(OCC)C(C)OC)C(=O)O |
| InChI | InChI=1S/C21H42O8/c1-10-13-15-27-21(26-14-11-2,28-16(4)5)19(7,18(22)23)29-20(8,25-12-3)17(6)24-9/h16-17H,10-15H2,1-9H3,(H,22,23) |
| InChIKey | LIHMVSLPHOGCDZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|