C45H94O9 — CID 159549914
2-butan-2-yloxy-3-butoxy-1-heptan-2-yloxy-2-(2-methylpropoxy)-1-pentoxy-1-(3-pentoxyhexoxy)-3-propan-2-yloxyheptane;hydrate (PubChem CID 159549914) has the molecular formula C45H94O9 and a molecular weight of 779.24 g/mol. Its IUPAC name is 2-butan-2-yloxy-3-butoxy-1-heptan-2-yloxy-2-(2-methylpropoxy)-1-pentoxy-1-(3-pentoxyhexoxy)-3-propan-2-yloxyheptane;hydrate.
| Compound Name | 2-butan-2-yloxy-3-butoxy-1-heptan-2-yloxy-2-(2-methylpropoxy)-1-pentoxy-1-(3-pentoxyhexoxy)-3-propan-2-yloxyheptane;hydrate |
|---|---|
| PubChem CID | 159549914 |
| Molecular Formula | C45H94O9 |
| Molecular Weight | 779.24 g/mol |
| Exact Mass | 778.69 |
| IUPAC Name | 2-butan-2-yloxy-3-butoxy-1-heptan-2-yloxy-2-(2-methylpropoxy)-1-pentoxy-1-(3-pentoxyhexoxy)-3-propan-2-yloxyheptane;hydrate |
| SMILES | CCCCCOC(CCC)CCOC(OCCCCC)(OC(C)CCCCC)C(OCC(C)C)(OC(C)CC)C(CCCC)(OCCCC)OC(C)C.O |
| InChI | InChI=1S/C45H92O8.H2O/c1-14-21-26-30-41(13)53-45(48-35-28-23-16-3,49-36-31-42(29-19-6)46-33-27-22-15-2)44(50-37-38(8)9,52-40(12)20-7)43(32-24-17-4,51-39(10)11)47-34-25-18-5;/h38-42H,14-37H2,1-13H3;1H2 |
| InChIKey | GYKDDLWCANBPFZ-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 105.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.24 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|