C24H24N4O4 — CID 141013884
[4-[(3,4-dicarbamimidoylphenoxy)methyl]-2-phenylphenyl]methyl 2-hydroxyacetate (PubChem CID 141013884) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is [4-[(3,4-dicarbamimidoylphenoxy)methyl]-2-phenylphenyl]methyl 2-hydroxyacetate.
| Compound Name | [4-[(3,4-dicarbamimidoylphenoxy)methyl]-2-phenylphenyl]methyl 2-hydroxyacetate |
|---|---|
| PubChem CID | 141013884 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | [4-[(3,4-dicarbamimidoylphenoxy)methyl]-2-phenylphenyl]methyl 2-hydroxyacetate |
| SMILES | [H]/N=C(\N)c1ccc(OCc2ccc(COC(=O)CO)c(-c3ccccc3)c2)cc1/C(N)=N/[H] |
| InChI | InChI=1S/C24H24N4O4/c25-23(26)19-9-8-18(11-21(19)24(27)28)31-13-15-6-7-17(14-32-22(30)12-29)20(10-15)16-4-2-1-3-5-16/h1-11,29H,12-14H2,(H3,25,26)(H3,27,28) |
| InChIKey | DZPXQFQTIAKMFJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 155.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|