C18H18Cl2O2P- — CID 141015941
(2,6-dichlorophenyl)-(4-pentoxyphenyl)phosphanylidenemethanolate (PubChem CID 141015941) has the molecular formula C18H18Cl2O2P- and a molecular weight of 368.22 g/mol. Its IUPAC name is (2,6-dichlorophenyl)-(4-pentoxyphenyl)phosphanylidenemethanolate.
| Compound Name | (2,6-dichlorophenyl)-(4-pentoxyphenyl)phosphanylidenemethanolate |
|---|---|
| PubChem CID | 141015941 |
| Molecular Formula | C18H18Cl2O2P- |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | (2,6-dichlorophenyl)-(4-pentoxyphenyl)phosphanylidenemethanolate |
| SMILES | CCCCCOc1ccc(/P=C(\[O-])c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C18H19Cl2O2P/c1-2-3-4-12-22-13-8-10-14(11-9-13)23-18(21)17-15(19)6-5-7-16(17)20/h5-11,21H,2-4,12H2,1H3/p-1 |
| InChIKey | MMRKKHJRJMUKTH-UHFFFAOYSA-M |
| XLogP | 4.67 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|