C25H34O3P- — CID 141015913
(2,6-dimethylphenyl)-(2,4-dipentoxyphenyl)phosphanylidenemethanolate (PubChem CID 141015913) has the molecular formula C25H34O3P- and a molecular weight of 413.52 g/mol. Its IUPAC name is (2,6-dimethylphenyl)-(2,4-dipentoxyphenyl)phosphanylidenemethanolate.
| Compound Name | (2,6-dimethylphenyl)-(2,4-dipentoxyphenyl)phosphanylidenemethanolate |
|---|---|
| PubChem CID | 141015913 |
| Molecular Formula | C25H34O3P- |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | (2,6-dimethylphenyl)-(2,4-dipentoxyphenyl)phosphanylidenemethanolate |
| SMILES | CCCCCOc1ccc(/P=C(\[O-])c2c(C)cccc2C)c(OCCCCC)c1 |
| InChI | InChI=1S/C25H35O3P/c1-5-7-9-16-27-21-14-15-23(22(18-21)28-17-10-8-6-2)29-25(26)24-19(3)12-11-13-20(24)4/h11-15,18,26H,5-10,16-17H2,1-4H3/p-1 |
| InChIKey | KVEKBNRHDIQPOS-UHFFFAOYSA-M |
| XLogP | 5.55 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|