About [2,4-bis(3-methylbutoxy)phenyl]phosphanylidene-(2-chloro-6-methylphenyl)methanolate
[2,4-bis(3-methylbutoxy)phenyl]phosphanylidene-(2-chloro-6-methylphenyl)methanolate (PubChem CID 141016833) has the molecular formula C24H31ClO3P-
and a molecular weight of 433.94 g/mol. Its IUPAC name is [2,4-bis(3-methylbutoxy)phenyl]phosphanylidene-(2-chloro-6-methylphenyl)methanolate.
Molecular Properties
| Compound Name | [2,4-bis(3-methylbutoxy)phenyl]phosphanylidene-(2-chloro-6-methylphenyl)methanolate |
| PubChem CID | 141016833 |
| Molecular Formula | C24H31ClO3P- |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | [2,4-bis(3-methylbutoxy)phenyl]phosphanylidene-(2-chloro-6-methylphenyl)methanolate |
| SMILES | Cc1cccc(Cl)c1/C([O-])=P/c1ccc(OCCC(C)C)cc1OCCC(C)C |
| InChI | InChI=1S/C24H32ClO3P/c1-16(2)11-13-27-19-9-10-22(21(15-19)28-14-12-17(3)4)29-24(26)23-18(5)7-6-8-20(23)25/h6-10,15-17,26H,11-14H2,1-5H3/p-1 |
| InChIKey | OHVZAHNWHGUFHC-UHFFFAOYSA-M |
| XLogP | 5.61 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2,4-bis(3-methylbutoxy)phenyl]phosphanylidene-(2-chloro-6-methylphenyl)methanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-bis(3-methylbutoxy)phenyl]phosphanylidene-(2-chloro-6-methylphenyl)methanolate?
The IUPAC name of [2,4-bis(3-methylbutoxy)phenyl]phosphanylidene-(2-chloro-6-methylphenyl)methanolate (CID 141016833) is [2,4-bis(3-methylbutoxy)phenyl]phosphanylidene-(2-chloro-6-methylphenyl)methanolate.
What is the SMILES notation for [2,4-bis(3-methylbutoxy)phenyl]phosphanylidene-(2-chloro-6-methylphenyl)methanolate?
The canonical SMILES for [2,4-bis(3-methylbutoxy)phenyl]phosphanylidene-(2-chloro-6-methylphenyl)methanolate is Cc1cccc(Cl)c1/C([O-])=P/c1ccc(OCCC(C)C)cc1OCCC(C)C.
What is the InChIKey of [2,4-bis(3-methylbutoxy)phenyl]phosphanylidene-(2-chloro-6-methylphenyl)methanolate?
The InChIKey is OHVZAHNWHGUFHC-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H32ClO3P/c1-16(2)11-13-27-19-9-10-22(21(15-19)28-14-12-17(3)4)29-24(26)23-18(5)7-6-8-20(23)25/h6-10,15-17,26H,11-14H2,1-5H3/p-1.
What are the key properties of [2,4-bis(3-methylbutoxy)phenyl]phosphanylidene-(2-chloro-6-methylphenyl)methanolate?
[2,4-bis(3-methylbutoxy)phenyl]phosphanylidene-(2-chloro-6-methylphenyl)methanolate has a molecular weight of 433.94 g/mol, XLogP of 5.61, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-bis(3-methylbutoxy)phenyl]phosphanylidene-(2-chloro-6-methylphenyl)methanolate is sourced from PubChem (CID 141016833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).