C27H38O4P- — CID 141016517
(2,6-dimethylphenyl)-(2,4,6-tributoxyphenyl)phosphanylidenemethanolate (PubChem CID 141016517) has the molecular formula C27H38O4P- and a molecular weight of 457.57 g/mol. Its IUPAC name is (2,6-dimethylphenyl)-(2,4,6-tributoxyphenyl)phosphanylidenemethanolate.
| Compound Name | (2,6-dimethylphenyl)-(2,4,6-tributoxyphenyl)phosphanylidenemethanolate |
|---|---|
| PubChem CID | 141016517 |
| Molecular Formula | C27H38O4P- |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | (2,6-dimethylphenyl)-(2,4,6-tributoxyphenyl)phosphanylidenemethanolate |
| SMILES | CCCCOc1cc(OCCCC)c(/P=C(\[O-])c2c(C)cccc2C)c(OCCCC)c1 |
| InChI | InChI=1S/C27H39O4P/c1-6-9-15-29-22-18-23(30-16-10-7-2)26(24(19-22)31-17-11-8-3)32-27(28)25-20(4)13-12-14-21(25)5/h12-14,18-19,28H,6-11,15-17H2,1-5H3/p-1 |
| InChIKey | XENFMPKSLXGMFA-UHFFFAOYSA-M |
| XLogP | 5.95 |
| TPSA | 50.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|