C27H29O6P — CID 141016379
[phenyl-(2,3,4,6-tetramethylbenzoyl)phosphanyl] 2,4,6-trimethoxybenzoate (PubChem CID 141016379) has the molecular formula C27H29O6P and a molecular weight of 480.50 g/mol. Its IUPAC name is [phenyl-(2,3,4,6-tetramethylbenzoyl)phosphanyl] 2,4,6-trimethoxybenzoate.
| Compound Name | [phenyl-(2,3,4,6-tetramethylbenzoyl)phosphanyl] 2,4,6-trimethoxybenzoate |
|---|---|
| PubChem CID | 141016379 |
| Molecular Formula | C27H29O6P |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | [phenyl-(2,3,4,6-tetramethylbenzoyl)phosphanyl] 2,4,6-trimethoxybenzoate |
| SMILES | COc1cc(OC)c(C(=O)OP(C(=O)c2c(C)cc(C)c(C)c2C)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C27H29O6P/c1-16-13-17(2)24(19(4)18(16)3)27(29)34(21-11-9-8-10-12-21)33-26(28)25-22(31-6)14-20(30-5)15-23(25)32-7/h8-15H,1-7H3 |
| InChIKey | WZEAFABBILAJKN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|