1H-inden-1-yl 2,4-dimethoxy-6-methylbenzoate

C19H18O4 — CID 174707762

IUPAC1H-inden-1-yl 2,4-dimethoxy-6-methylbenzoate
SMILESCOc1cc(C)c(C(=O)OC2C=Cc3ccccc32)c(OC)c1
InChIInChI=1S/C19H18O4/c1-12-10-14(21-2)11-17(22-3)18(12)19(20)23-16-9-8-13-6-4-5-7-15(13)16/h4-11,16H,1-3H3
InChIKeyKDFGWVSKVHQRPD-UHFFFAOYSA-N
MW310.35 g/mol
LogP3.94
Rot. Bonds4

About 1H-inden-1-yl 2,4-dimethoxy-6-methylbenzoate

1H-inden-1-yl 2,4-dimethoxy-6-methylbenzoate (PubChem CID 174707762) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is 1H-inden-1-yl 2,4-dimethoxy-6-methylbenzoate.

Molecular Properties

Compound Name1H-inden-1-yl 2,4-dimethoxy-6-methylbenzoate
PubChem CID174707762
Molecular FormulaC19H18O4
Molecular Weight310.35 g/mol
Exact Mass310.12
IUPAC Name1H-inden-1-yl 2,4-dimethoxy-6-methylbenzoate
SMILESCOc1cc(C)c(C(=O)OC2C=Cc3ccccc32)c(OC)c1
InChIInChI=1S/C19H18O4/c1-12-10-14(21-2)11-17(22-3)18(12)19(20)23-16-9-8-13-6-4-5-7-15(13)16/h4-11,16H,1-3H3
InChIKeyKDFGWVSKVHQRPD-UHFFFAOYSA-N
XLogP3.94
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.35
LogP ≤ 53.94
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 1H-inden-1-yl 2,4-dimethoxy-6-methylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1H-inden-1-yl 2,4-dimethoxy-6-methylbenzoate?
The IUPAC name of 1H-inden-1-yl 2,4-dimethoxy-6-methylbenzoate (CID 174707762) is 1H-inden-1-yl 2,4-dimethoxy-6-methylbenzoate.
What is the SMILES notation for 1H-inden-1-yl 2,4-dimethoxy-6-methylbenzoate?
The canonical SMILES for 1H-inden-1-yl 2,4-dimethoxy-6-methylbenzoate is COc1cc(C)c(C(=O)OC2C=Cc3ccccc32)c(OC)c1.
What is the InChIKey of 1H-inden-1-yl 2,4-dimethoxy-6-methylbenzoate?
The InChIKey is KDFGWVSKVHQRPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O4/c1-12-10-14(21-2)11-17(22-3)18(12)19(20)23-16-9-8-13-6-4-5-7-15(13)16/h4-11,16H,1-3H3.
What are the key properties of 1H-inden-1-yl 2,4-dimethoxy-6-methylbenzoate?
1H-inden-1-yl 2,4-dimethoxy-6-methylbenzoate has a molecular weight of 310.35 g/mol, XLogP of 3.94, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-inden-1-yl 2,4-dimethoxy-6-methylbenzoate is sourced from PubChem (CID 174707762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).