C15H25F5O3S — CID 141018072
2-butyl-6-(4,4,5,5,5-pentafluoropentylsulfinyl)hexanoic acid (PubChem CID 141018072) has the molecular formula C15H25F5O3S and a molecular weight of 380.42 g/mol. Its IUPAC name is 2-butyl-6-(4,4,5,5,5-pentafluoropentylsulfinyl)hexanoic acid.
| Compound Name | 2-butyl-6-(4,4,5,5,5-pentafluoropentylsulfinyl)hexanoic acid |
|---|---|
| PubChem CID | 141018072 |
| Molecular Formula | C15H25F5O3S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 2-butyl-6-(4,4,5,5,5-pentafluoropentylsulfinyl)hexanoic acid |
| SMILES | CCCCC(CCCCS(=O)CCCC(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C15H25F5O3S/c1-2-3-7-12(13(21)22)8-4-5-10-24(23)11-6-9-14(16,17)15(18,19)20/h12H,2-11H2,1H3,(H,21,22) |
| InChIKey | IABQZZFGDXIWBF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|