C12H26N8O — CID 141018487
2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-piperidin-3-ylamino]guanidine (PubChem CID 141018487) has the molecular formula C12H26N8O and a molecular weight of 298.40 g/mol. Its IUPAC name is 2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-piperidin-3-ylamino]guanidine.
| Compound Name | 2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-piperidin-3-ylamino]guanidine |
|---|---|
| PubChem CID | 141018487 |
| Molecular Formula | C12H26N8O |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-piperidin-3-ylamino]guanidine |
| SMILES | NC(N)=NCCC[C@@H](C=O)N(N=C(N)N)C1CCCNC1 |
| InChI | InChI=1S/C12H26N8O/c13-11(14)18-6-2-4-10(8-21)20(19-12(15)16)9-3-1-5-17-7-9/h8-10,17H,1-7H2,(H4,13,14,18)(H4,15,16,19)/t9?,10-/m0/s1 |
| InChIKey | GRNYQAQCTJRXKC-AXDSSHIGSA-N |
| XLogP | -2.15 |
| TPSA | 161.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|