C21H39ClN6O3 — CID 22854955
(2S)-N-cyclohexyl-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[(2S)-2-(methylamino)propanoyl]pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 22854955) has the molecular formula C21H39ClN6O3 and a molecular weight of 459.04 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[(2S)-2-(methylamino)propanoyl]pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | (2S)-N-cyclohexyl-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[(2S)-2-(methylamino)propanoyl]pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 22854955 |
| Molecular Formula | C21H39ClN6O3 |
| Molecular Weight | 459.04 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | (2S)-N-cyclohexyl-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[(2S)-2-(methylamino)propanoyl]pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | CN[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N(C1CCCCC1)[C@H](C=O)CCCN=C(N)N.Cl |
| InChI | InChI=1S/C21H38N6O3.ClH/c1-15(24-2)19(29)26-13-7-11-18(26)20(30)27(16-8-4-3-5-9-16)17(14-28)10-6-12-25-21(22)23;/h14-18,24H,3-13H2,1-2H3,(H4,22,23,25);1H/t15-,17-,18-;/m0./s1 |
| InChIKey | YRZGWURMHQHXCF-OOAIBONUSA-N |
| XLogP | 0.79 |
| TPSA | 134.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.04 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|