C17H25N2O2P — CID 141021913
6-(3-diethylphosphorylfuran-2-yl)-3,5-diethylpyridin-2-amine (PubChem CID 141021913) has the molecular formula C17H25N2O2P and a molecular weight of 320.37 g/mol. Its IUPAC name is 6-(3-diethylphosphorylfuran-2-yl)-3,5-diethylpyridin-2-amine.
| Compound Name | 6-(3-diethylphosphorylfuran-2-yl)-3,5-diethylpyridin-2-amine |
|---|---|
| PubChem CID | 141021913 |
| Molecular Formula | C17H25N2O2P |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 6-(3-diethylphosphorylfuran-2-yl)-3,5-diethylpyridin-2-amine |
| SMILES | CCc1cc(CC)c(-c2occc2P(=O)(CC)CC)nc1N |
| InChI | InChI=1S/C17H25N2O2P/c1-5-12-11-13(6-2)17(18)19-15(12)16-14(9-10-21-16)22(20,7-3)8-4/h9-11H,5-8H2,1-4H3,(H2,18,19) |
| InChIKey | DANNQRXTQWJKMK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|